C23H27NO5 — CID 152950467
prop-2-enyl N-[[4-[[(3R)-4-(4-hydroxyphenyl)-3-methyl-2-oxobutoxy]methyl]phenyl]methyl]carbamate (PubChem CID 152950467) has the molecular formula C23H27NO5 and a molecular weight of 397.47 g/mol. Its IUPAC name is prop-2-enyl N-[[4-[[(3R)-4-(4-hydroxyphenyl)-3-methyl-2-oxobutoxy]methyl]phenyl]methyl]carbamate.
| Compound Name | prop-2-enyl N-[[4-[[(3R)-4-(4-hydroxyphenyl)-3-methyl-2-oxobutoxy]methyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 152950467 |
| Molecular Formula | C23H27NO5 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | prop-2-enyl N-[[4-[[(3R)-4-(4-hydroxyphenyl)-3-methyl-2-oxobutoxy]methyl]phenyl]methyl]carbamate |
| SMILES | C=CCOC(=O)NCc1ccc(COCC(=O)[C@H](C)Cc2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C23H27NO5/c1-3-12-29-23(27)24-14-19-4-6-20(7-5-19)15-28-16-22(26)17(2)13-18-8-10-21(25)11-9-18/h3-11,17,25H,1,12-16H2,2H3,(H,24,27)/t17-/m1/s1 |
| InChIKey | UOPJKCBQJBACKN-QGZVFWFLSA-N |
| XLogP | 3.77 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|