C8H12N2O2 — CID 110374915
ethyl N-(1H-pyrrol-2-ylmethyl)carbamate (PubChem CID 110374915) has the molecular formula C8H12N2O2 and a molecular weight of 168.20 g/mol. Its IUPAC name is ethyl N-(1H-pyrrol-2-ylmethyl)carbamate.
| Compound Name | ethyl N-(1H-pyrrol-2-ylmethyl)carbamate |
|---|---|
| PubChem CID | 110374915 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | ethyl N-(1H-pyrrol-2-ylmethyl)carbamate |
| SMILES | CCOC(=O)NCc1ccc[nH]1 |
| InChI | InChI=1S/C8H12N2O2/c1-2-12-8(11)10-6-7-4-3-5-9-7/h3-5,9H,2,6H2,1H3,(H,10,11) |
| InChIKey | RAIZPZYBEBCWMD-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |