C11H11F2NO4 — CID 115163429
3-[(2,5-difluoro-4-methoxyphenyl)methylamino]-3-oxopropanoic acid (PubChem CID 115163429) has the molecular formula C11H11F2NO4 and a molecular weight of 259.21 g/mol. Its IUPAC name is 3-[(2,5-difluoro-4-methoxyphenyl)methylamino]-3-oxopropanoic acid.
| Compound Name | 3-[(2,5-difluoro-4-methoxyphenyl)methylamino]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 115163429 |
| Molecular Formula | C11H11F2NO4 |
| Molecular Weight | 259.21 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | 3-[(2,5-difluoro-4-methoxyphenyl)methylamino]-3-oxopropanoic acid |
| SMILES | COc1cc(F)c(CNC(=O)CC(=O)O)cc1F |
| InChI | InChI=1S/C11H11F2NO4/c1-18-9-3-7(12)6(2-8(9)13)5-14-10(15)4-11(16)17/h2-3H,4-5H2,1H3,(H,14,15)(H,16,17) |
| InChIKey | SIGDKBOVTWMWEJ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.21 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|