C13H20ClN3O4 — CID 173289228
3,4-dimethyl-2,6-dinitro-N-pentan-3-ylaniline;hydrochloride (PubChem CID 173289228) has the molecular formula C13H20ClN3O4 and a molecular weight of 317.77 g/mol. Its IUPAC name is 3,4-dimethyl-2,6-dinitro-N-pentan-3-ylaniline;hydrochloride.
| Compound Name | 3,4-dimethyl-2,6-dinitro-N-pentan-3-ylaniline;hydrochloride |
|---|---|
| PubChem CID | 173289228 |
| Molecular Formula | C13H20ClN3O4 |
| Molecular Weight | 317.77 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | 3,4-dimethyl-2,6-dinitro-N-pentan-3-ylaniline;hydrochloride |
| SMILES | CCC(CC)Nc1c([N+](=O)[O-])cc(C)c(C)c1[N+](=O)[O-].Cl |
| InChI | InChI=1S/C13H19N3O4.ClH/c1-5-10(6-2)14-12-11(15(17)18)7-8(3)9(4)13(12)16(19)20;/h7,10,14H,5-6H2,1-4H3;1H |
| InChIKey | NTMUBOPEFHABAI-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.77 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|