About [6-methyl-2,4-dinitro-3-(pentan-3-ylamino)phenyl]methyl 2-chloroacetate
[6-methyl-2,4-dinitro-3-(pentan-3-ylamino)phenyl]methyl 2-chloroacetate (PubChem CID 12940766) has the molecular formula C15H20ClN3O6
and a molecular weight of 373.79 g/mol. Its IUPAC name is [6-methyl-2,4-dinitro-3-(pentan-3-ylamino)phenyl]methyl 2-chloroacetate.
Molecular Properties
| Compound Name | [6-methyl-2,4-dinitro-3-(pentan-3-ylamino)phenyl]methyl 2-chloroacetate |
| PubChem CID | 12940766 |
| Molecular Formula | C15H20ClN3O6 |
| Molecular Weight | 373.79 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | [6-methyl-2,4-dinitro-3-(pentan-3-ylamino)phenyl]methyl 2-chloroacetate |
| SMILES | CCC(CC)Nc1c([N+](=O)[O-])cc(C)c(COC(=O)CCl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H20ClN3O6/c1-4-10(5-2)17-14-12(18(21)22)6-9(3)11(15(14)19(23)24)8-25-13(20)7-16/h6,10,17H,4-5,7-8H2,1-3H3 |
| InChIKey | LTANTWIUKYWAMX-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 124.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.79 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [6-methyl-2,4-dinitro-3-(pentan-3-ylamino)phenyl]methyl 2-chloroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-methyl-2,4-dinitro-3-(pentan-3-ylamino)phenyl]methyl 2-chloroacetate?
The IUPAC name of [6-methyl-2,4-dinitro-3-(pentan-3-ylamino)phenyl]methyl 2-chloroacetate (CID 12940766) is [6-methyl-2,4-dinitro-3-(pentan-3-ylamino)phenyl]methyl 2-chloroacetate.
What is the SMILES notation for [6-methyl-2,4-dinitro-3-(pentan-3-ylamino)phenyl]methyl 2-chloroacetate?
The canonical SMILES for [6-methyl-2,4-dinitro-3-(pentan-3-ylamino)phenyl]methyl 2-chloroacetate is CCC(CC)Nc1c([N+](=O)[O-])cc(C)c(COC(=O)CCl)c1[N+](=O)[O-].
What is the InChIKey of [6-methyl-2,4-dinitro-3-(pentan-3-ylamino)phenyl]methyl 2-chloroacetate?
The InChIKey is LTANTWIUKYWAMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20ClN3O6/c1-4-10(5-2)17-14-12(18(21)22)6-9(3)11(15(14)19(23)24)8-25-13(20)7-16/h6,10,17H,4-5,7-8H2,1-3H3.
What are the key properties of [6-methyl-2,4-dinitro-3-(pentan-3-ylamino)phenyl]methyl 2-chloroacetate?
[6-methyl-2,4-dinitro-3-(pentan-3-ylamino)phenyl]methyl 2-chloroacetate has a molecular weight of 373.79 g/mol, XLogP of 3.69, 9 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [6-methyl-2,4-dinitro-3-(pentan-3-ylamino)phenyl]methyl 2-chloroacetate is sourced from PubChem (CID 12940766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).