C12H14ClN3O4 — CID 173460172
3-(2-chloroethyl)-4-methyl-2,6-dinitro-N-prop-1-enylaniline (PubChem CID 173460172) has the molecular formula C12H14ClN3O4 and a molecular weight of 299.71 g/mol. Its IUPAC name is 3-(2-chloroethyl)-4-methyl-2,6-dinitro-N-prop-1-enylaniline.
| Compound Name | 3-(2-chloroethyl)-4-methyl-2,6-dinitro-N-prop-1-enylaniline |
|---|---|
| PubChem CID | 173460172 |
| Molecular Formula | C12H14ClN3O4 |
| Molecular Weight | 299.71 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | 3-(2-chloroethyl)-4-methyl-2,6-dinitro-N-prop-1-enylaniline |
| SMILES | CC=CNc1c([N+](=O)[O-])cc(C)c(CCCl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H14ClN3O4/c1-3-6-14-11-10(15(17)18)7-8(2)9(4-5-13)12(11)16(19)20/h3,6-7,14H,4-5H2,1-2H3 |
| InChIKey | FHLTXBDDDGURCP-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.71 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|