C9H9ClN2O5 — CID 20563836
4-chloro-2-(methoxymethyl)-1-methyl-3,5-dinitrobenzene (PubChem CID 20563836) has the molecular formula C9H9ClN2O5 and a molecular weight of 260.63 g/mol. Its IUPAC name is 4-chloro-2-(methoxymethyl)-1-methyl-3,5-dinitrobenzene.
| Compound Name | 4-chloro-2-(methoxymethyl)-1-methyl-3,5-dinitrobenzene |
|---|---|
| PubChem CID | 20563836 |
| Molecular Formula | C9H9ClN2O5 |
| Molecular Weight | 260.63 g/mol |
| Exact Mass | 260.02 |
| IUPAC Name | 4-chloro-2-(methoxymethyl)-1-methyl-3,5-dinitrobenzene |
| SMILES | COCc1c(C)cc([N+](=O)[O-])c(Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H9ClN2O5/c1-5-3-7(11(13)14)8(10)9(12(15)16)6(5)4-17-2/h3H,4H2,1-2H3 |
| InChIKey | FUGJUBNJIKAGIX-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 95.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.63 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|