C10H10BrClN2O4 — CID 168875960
2-bromo-1-tert-butyl-4-chloro-3,5-dinitrobenzene (PubChem CID 168875960) has the molecular formula C10H10BrClN2O4 and a molecular weight of 337.56 g/mol. Its IUPAC name is 2-bromo-1-tert-butyl-4-chloro-3,5-dinitrobenzene.
| Compound Name | 2-bromo-1-tert-butyl-4-chloro-3,5-dinitrobenzene |
|---|---|
| PubChem CID | 168875960 |
| Molecular Formula | C10H10BrClN2O4 |
| Molecular Weight | 337.56 g/mol |
| Exact Mass | 335.95 |
| IUPAC Name | 2-bromo-1-tert-butyl-4-chloro-3,5-dinitrobenzene |
| SMILES | CC(C)(C)c1cc([N+](=O)[O-])c(Cl)c([N+](=O)[O-])c1Br |
| InChI | InChI=1S/C10H10BrClN2O4/c1-10(2,3)5-4-6(13(15)16)8(12)9(7(5)11)14(17)18/h4H,1-3H3 |
| InChIKey | QJWHGDSNDMSHIT-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.56 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|