C10H6Cl2F3N3O4 — CID 21413090
3-chloro-N-(2-chloroprop-2-enyl)-2,6-dinitro-4-(trifluoromethyl)aniline (PubChem CID 21413090) has the molecular formula C10H6Cl2F3N3O4 and a molecular weight of 360.08 g/mol. Its IUPAC name is 3-chloro-N-(2-chloroprop-2-enyl)-2,6-dinitro-4-(trifluoromethyl)aniline.
| Compound Name | 3-chloro-N-(2-chloroprop-2-enyl)-2,6-dinitro-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 21413090 |
| Molecular Formula | C10H6Cl2F3N3O4 |
| Molecular Weight | 360.08 g/mol |
| Exact Mass | 358.97 |
| IUPAC Name | 3-chloro-N-(2-chloroprop-2-enyl)-2,6-dinitro-4-(trifluoromethyl)aniline |
| SMILES | C=C(Cl)CNc1c([N+](=O)[O-])cc(C(F)(F)F)c(Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H6Cl2F3N3O4/c1-4(11)3-16-8-6(17(19)20)2-5(10(13,14)15)7(12)9(8)18(21)22/h2,16H,1,3H2 |
| InChIKey | WDLKKNHWFOKLRK-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.08 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|