About [3-chloro-2,6-dinitro-4-(trifluoromethyl)phenyl]-pentyldiazene
[3-chloro-2,6-dinitro-4-(trifluoromethyl)phenyl]-pentyldiazene (PubChem CID 57068628) has the molecular formula C12H12ClF3N4O4
and a molecular weight of 368.70 g/mol. Its IUPAC name is [3-chloro-2,6-dinitro-4-(trifluoromethyl)phenyl]-pentyldiazene.
Molecular Properties
| Compound Name | [3-chloro-2,6-dinitro-4-(trifluoromethyl)phenyl]-pentyldiazene |
| PubChem CID | 57068628 |
| Molecular Formula | C12H12ClF3N4O4 |
| Molecular Weight | 368.70 g/mol |
| Exact Mass | 368.05 |
| IUPAC Name | [3-chloro-2,6-dinitro-4-(trifluoromethyl)phenyl]-pentyldiazene |
| SMILES | CCCCC/N=N/c1c([N+](=O)[O-])cc(C(F)(F)F)c(Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H12ClF3N4O4/c1-2-3-4-5-17-18-10-8(19(21)22)6-7(12(14,15)16)9(13)11(10)20(23)24/h6H,2-5H2,1H3/b18-17+ |
| InChIKey | KIAVFSMUZGORPV-ISLYRVAYSA-N |
| XLogP | 5.45 |
| TPSA | 111.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.70 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [3-chloro-2,6-dinitro-4-(trifluoromethyl)phenyl]-pentyldiazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-chloro-2,6-dinitro-4-(trifluoromethyl)phenyl]-pentyldiazene?
The IUPAC name of [3-chloro-2,6-dinitro-4-(trifluoromethyl)phenyl]-pentyldiazene (CID 57068628) is [3-chloro-2,6-dinitro-4-(trifluoromethyl)phenyl]-pentyldiazene.
What is the SMILES notation for [3-chloro-2,6-dinitro-4-(trifluoromethyl)phenyl]-pentyldiazene?
The canonical SMILES for [3-chloro-2,6-dinitro-4-(trifluoromethyl)phenyl]-pentyldiazene is CCCCC/N=N/c1c([N+](=O)[O-])cc(C(F)(F)F)c(Cl)c1[N+](=O)[O-].
What is the InChIKey of [3-chloro-2,6-dinitro-4-(trifluoromethyl)phenyl]-pentyldiazene?
The InChIKey is KIAVFSMUZGORPV-ISLYRVAYSA-N. The full InChI is InChI=1S/C12H12ClF3N4O4/c1-2-3-4-5-17-18-10-8(19(21)22)6-7(12(14,15)16)9(13)11(10)20(23)24/h6H,2-5H2,1H3/b18-17+.
What are the key properties of [3-chloro-2,6-dinitro-4-(trifluoromethyl)phenyl]-pentyldiazene?
[3-chloro-2,6-dinitro-4-(trifluoromethyl)phenyl]-pentyldiazene has a molecular weight of 368.70 g/mol, XLogP of 5.45, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-chloro-2,6-dinitro-4-(trifluoromethyl)phenyl]-pentyldiazene is sourced from PubChem (CID 57068628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).