C12H12ClF3N4O4 — CID 57068628
[3-chloro-2,6-dinitro-4-(trifluoromethyl)phenyl]-pentyldiazene (PubChem CID 57068628) has the molecular formula C12H12ClF3N4O4 and a molecular weight of 368.70 g/mol. Its IUPAC name is [3-chloro-2,6-dinitro-4-(trifluoromethyl)phenyl]-pentyldiazene.
| Compound Name | [3-chloro-2,6-dinitro-4-(trifluoromethyl)phenyl]-pentyldiazene |
|---|---|
| PubChem CID | 57068628 |
| Molecular Formula | C12H12ClF3N4O4 |
| Molecular Weight | 368.70 g/mol |
| Exact Mass | 368.05 |
| IUPAC Name | [3-chloro-2,6-dinitro-4-(trifluoromethyl)phenyl]-pentyldiazene |
| SMILES | CCCCC/N=N/c1c([N+](=O)[O-])cc(C(F)(F)F)c(Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H12ClF3N4O4/c1-2-3-4-5-17-18-10-8(19(21)22)6-7(12(14,15)16)9(13)11(10)20(23)24/h6H,2-5H2,1H3/b18-17+ |
| InChIKey | KIAVFSMUZGORPV-ISLYRVAYSA-N |
| XLogP | 5.45 |
| TPSA | 111.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.70 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|