C10H7ClF3N3O4 — CID 21413083
3-chloro-N-cyclopropyl-2,6-dinitro-4-(trifluoromethyl)aniline (PubChem CID 21413083) has the molecular formula C10H7ClF3N3O4 and a molecular weight of 325.63 g/mol. Its IUPAC name is 3-chloro-N-cyclopropyl-2,6-dinitro-4-(trifluoromethyl)aniline.
| Compound Name | 3-chloro-N-cyclopropyl-2,6-dinitro-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 21413083 |
| Molecular Formula | C10H7ClF3N3O4 |
| Molecular Weight | 325.63 g/mol |
| Exact Mass | 325.01 |
| IUPAC Name | 3-chloro-N-cyclopropyl-2,6-dinitro-4-(trifluoromethyl)aniline |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)c(Cl)c([N+](=O)[O-])c1NC1CC1 |
| InChI | InChI=1S/C10H7ClF3N3O4/c11-7-5(10(12,13)14)3-6(16(18)19)8(9(7)17(20)21)15-4-1-2-4/h3-4,15H,1-2H2 |
| InChIKey | IKNAZTACQCFMFT-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.63 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|