C14H8Cl2F6N4O4 — CID 88907698
(1E,3E)-4-chloro-5-N-[3-chloro-2,6-dinitro-4-(trifluoromethyl)phenyl]-2-(trifluoromethyl)hexa-1,3,5-triene-1,5-diamine (PubChem CID 88907698) has the molecular formula C14H8Cl2F6N4O4 and a molecular weight of 481.14 g/mol. Its IUPAC name is (1E,3E)-4-chloro-5-N-[3-chloro-2,6-dinitro-4-(trifluoromethyl)phenyl]-2-(trifluoromethyl)hexa-1,3,5-triene-1,5-diamine.
| Compound Name | (1E,3E)-4-chloro-5-N-[3-chloro-2,6-dinitro-4-(trifluoromethyl)phenyl]-2-(trifluoromethyl)hexa-1,3,5-triene-1,5-diamine |
|---|---|
| PubChem CID | 88907698 |
| Molecular Formula | C14H8Cl2F6N4O4 |
| Molecular Weight | 481.14 g/mol |
| Exact Mass | 479.98 |
| IUPAC Name | (1E,3E)-4-chloro-5-N-[3-chloro-2,6-dinitro-4-(trifluoromethyl)phenyl]-2-(trifluoromethyl)hexa-1,3,5-triene-1,5-diamine |
| SMILES | C=C(Nc1c([N+](=O)[O-])cc(C(F)(F)F)c(Cl)c1[N+](=O)[O-])/C(Cl)=C\C(=C/N)C(F)(F)F |
| InChI | InChI=1S/C14H8Cl2F6N4O4/c1-5(8(15)2-6(4-23)13(17,18)19)24-11-9(25(27)28)3-7(14(20,21)22)10(16)12(11)26(29)30/h2-4,24H,1,23H2/b6-4+,8-2+ |
| InChIKey | XWRYQIVRCSEVKG-LYUCFMSQSA-N |
| XLogP | 5.63 |
| TPSA | 124.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.14 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|