C13H5Cl3F3N3O4 — CID 21321500
3-chloro-N-(2,6-dichlorophenyl)-2,6-dinitro-4-(trifluoromethyl)aniline (PubChem CID 21321500) has the molecular formula C13H5Cl3F3N3O4 and a molecular weight of 430.55 g/mol. Its IUPAC name is 3-chloro-N-(2,6-dichlorophenyl)-2,6-dinitro-4-(trifluoromethyl)aniline.
| Compound Name | 3-chloro-N-(2,6-dichlorophenyl)-2,6-dinitro-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 21321500 |
| Molecular Formula | C13H5Cl3F3N3O4 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 428.93 |
| IUPAC Name | 3-chloro-N-(2,6-dichlorophenyl)-2,6-dinitro-4-(trifluoromethyl)aniline |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)c(Cl)c([N+](=O)[O-])c1Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C13H5Cl3F3N3O4/c14-6-2-1-3-7(15)10(6)20-11-8(21(23)24)4-5(13(17,18)19)9(16)12(11)22(25)26/h1-4,20H |
| InChIKey | WZFOFRISHPCLGD-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|