C15H5Cl2F6N3O5 — CID 14478865
2-chloro-N-[3-chloro-2,6-dinitro-4-(trifluoromethyl)phenyl]-4-(trifluoromethyl)benzamide (PubChem CID 14478865) has the molecular formula C15H5Cl2F6N3O5 and a molecular weight of 492.12 g/mol. Its IUPAC name is 2-chloro-N-[3-chloro-2,6-dinitro-4-(trifluoromethyl)phenyl]-4-(trifluoromethyl)benzamide.
| Compound Name | 2-chloro-N-[3-chloro-2,6-dinitro-4-(trifluoromethyl)phenyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 14478865 |
| Molecular Formula | C15H5Cl2F6N3O5 |
| Molecular Weight | 492.12 g/mol |
| Exact Mass | 490.95 |
| IUPAC Name | 2-chloro-N-[3-chloro-2,6-dinitro-4-(trifluoromethyl)phenyl]-4-(trifluoromethyl)benzamide |
| SMILES | O=C(Nc1c([N+](=O)[O-])cc(C(F)(F)F)c(Cl)c1[N+](=O)[O-])c1ccc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C15H5Cl2F6N3O5/c16-8-3-5(14(18,19)20)1-2-6(8)13(27)24-11-9(25(28)29)4-7(15(21,22)23)10(17)12(11)26(30)31/h1-4H,(H,24,27) |
| InChIKey | UWETWSFGHBCJFJ-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 115.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.12 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|