C16H8ClF3N4O5 — CID 173398367
N-(3-chloro-4-cyano-2,6-dinitrophenyl)-2-methyl-4-(trifluoromethyl)benzamide (PubChem CID 173398367) has the molecular formula C16H8ClF3N4O5 and a molecular weight of 428.71 g/mol. Its IUPAC name is N-(3-chloro-4-cyano-2,6-dinitrophenyl)-2-methyl-4-(trifluoromethyl)benzamide.
| Compound Name | N-(3-chloro-4-cyano-2,6-dinitrophenyl)-2-methyl-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 173398367 |
| Molecular Formula | C16H8ClF3N4O5 |
| Molecular Weight | 428.71 g/mol |
| Exact Mass | 428.01 |
| IUPAC Name | N-(3-chloro-4-cyano-2,6-dinitrophenyl)-2-methyl-4-(trifluoromethyl)benzamide |
| SMILES | Cc1cc(C(F)(F)F)ccc1C(=O)Nc1c([N+](=O)[O-])cc(C#N)c(Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C16H8ClF3N4O5/c1-7-4-9(16(18,19)20)2-3-10(7)15(25)22-13-11(23(26)27)5-8(6-21)12(17)14(13)24(28)29/h2-5H,1H3,(H,22,25) |
| InChIKey | NGQKEAMNOBGSCM-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 139.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.71 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|