C11H11ClF3N3O5 — CID 20571869
3-chloro-N-(3-methoxypropyl)-2,6-dinitro-4-(trifluoromethyl)aniline (PubChem CID 20571869) has the molecular formula C11H11ClF3N3O5 and a molecular weight of 357.67 g/mol. Its IUPAC name is 3-chloro-N-(3-methoxypropyl)-2,6-dinitro-4-(trifluoromethyl)aniline.
| Compound Name | 3-chloro-N-(3-methoxypropyl)-2,6-dinitro-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 20571869 |
| Molecular Formula | C11H11ClF3N3O5 |
| Molecular Weight | 357.67 g/mol |
| Exact Mass | 357.03 |
| IUPAC Name | 3-chloro-N-(3-methoxypropyl)-2,6-dinitro-4-(trifluoromethyl)aniline |
| SMILES | COCCCNc1c([N+](=O)[O-])cc(C(F)(F)F)c(Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H11ClF3N3O5/c1-23-4-2-3-16-9-7(17(19)20)5-6(11(13,14)15)8(12)10(9)18(21)22/h5,16H,2-4H2,1H3 |
| InChIKey | WUDWGEKDWQJABF-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 107.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.67 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|