C11H9F3N2O4S2 — CID 20571867
4-(2-methoxyethylamino)-5-nitro-7-(trifluoromethyl)-1,3-benzodithiol-2-one (PubChem CID 20571867) has the molecular formula C11H9F3N2O4S2 and a molecular weight of 354.33 g/mol. Its IUPAC name is 4-(2-methoxyethylamino)-5-nitro-7-(trifluoromethyl)-1,3-benzodithiol-2-one.
| Compound Name | 4-(2-methoxyethylamino)-5-nitro-7-(trifluoromethyl)-1,3-benzodithiol-2-one |
|---|---|
| PubChem CID | 20571867 |
| Molecular Formula | C11H9F3N2O4S2 |
| Molecular Weight | 354.33 g/mol |
| Exact Mass | 354.00 |
| IUPAC Name | 4-(2-methoxyethylamino)-5-nitro-7-(trifluoromethyl)-1,3-benzodithiol-2-one |
| SMILES | COCCNc1c([N+](=O)[O-])cc(C(F)(F)F)c2sc(=O)sc12 |
| InChI | InChI=1S/C11H9F3N2O4S2/c1-20-3-2-15-7-6(16(18)19)4-5(11(12,13)14)8-9(7)22-10(17)21-8/h4,15H,2-3H2,1H3 |
| InChIKey | ADZICSPYHQIASV-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.33 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|