C10H10ClN3O6 — CID 132593762
4-(2-methoxyethylamino)-3,5-dinitrobenzoyl chloride (PubChem CID 132593762) has the molecular formula C10H10ClN3O6 and a molecular weight of 303.66 g/mol. Its IUPAC name is 4-(2-methoxyethylamino)-3,5-dinitrobenzoyl chloride.
| Compound Name | 4-(2-methoxyethylamino)-3,5-dinitrobenzoyl chloride |
|---|---|
| PubChem CID | 132593762 |
| Molecular Formula | C10H10ClN3O6 |
| Molecular Weight | 303.66 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | 4-(2-methoxyethylamino)-3,5-dinitrobenzoyl chloride |
| SMILES | COCCNc1c([N+](=O)[O-])cc(C(=O)Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H10ClN3O6/c1-20-3-2-12-9-7(13(16)17)4-6(10(11)15)5-8(9)14(18)19/h4-5,12H,2-3H2,1H3 |
| InChIKey | WEMUHXNMDQMPQA-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 124.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.66 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|