C11H12F3N3O5 — CID 154202505
3-methoxy-2,6-dinitro-N-propan-2-yl-4-(trifluoromethyl)aniline (PubChem CID 154202505) has the molecular formula C11H12F3N3O5 and a molecular weight of 323.23 g/mol. Its IUPAC name is 3-methoxy-2,6-dinitro-N-propan-2-yl-4-(trifluoromethyl)aniline.
| Compound Name | 3-methoxy-2,6-dinitro-N-propan-2-yl-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 154202505 |
| Molecular Formula | C11H12F3N3O5 |
| Molecular Weight | 323.23 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | 3-methoxy-2,6-dinitro-N-propan-2-yl-4-(trifluoromethyl)aniline |
| SMILES | COc1c(C(F)(F)F)cc([N+](=O)[O-])c(NC(C)C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H12F3N3O5/c1-5(2)15-8-7(16(18)19)4-6(11(12,13)14)10(22-3)9(8)17(20)21/h4-5,15H,1-3H3 |
| InChIKey | HBDSZHRSGIDZMZ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 107.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.23 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|