C14H6ClF3N4O4 — CID 21321515
3-[3-chloro-2,6-dinitro-4-(trifluoromethyl)anilino]benzonitrile (PubChem CID 21321515) has the molecular formula C14H6ClF3N4O4 and a molecular weight of 386.67 g/mol. Its IUPAC name is 3-[3-chloro-2,6-dinitro-4-(trifluoromethyl)anilino]benzonitrile.
| Compound Name | 3-[3-chloro-2,6-dinitro-4-(trifluoromethyl)anilino]benzonitrile |
|---|---|
| PubChem CID | 21321515 |
| Molecular Formula | C14H6ClF3N4O4 |
| Molecular Weight | 386.67 g/mol |
| Exact Mass | 386.00 |
| IUPAC Name | 3-[3-chloro-2,6-dinitro-4-(trifluoromethyl)anilino]benzonitrile |
| SMILES | N#Cc1cccc(Nc2c([N+](=O)[O-])cc(C(F)(F)F)c(Cl)c2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H6ClF3N4O4/c15-11-9(14(16,17)18)5-10(21(23)24)12(13(11)22(25)26)20-8-3-1-2-7(4-8)6-19/h1-5,20H |
| InChIKey | DNYAHFRMMQCPPX-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 122.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.67 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|