C15H17F3N4O6S — CID 133348549
1-cyclopropylsulfonyl-N-[2,6-dinitro-4-(trifluoromethyl)phenyl]piperidin-4-amine (PubChem CID 133348549) has the molecular formula C15H17F3N4O6S and a molecular weight of 438.38 g/mol. Its IUPAC name is 1-cyclopropylsulfonyl-N-[2,6-dinitro-4-(trifluoromethyl)phenyl]piperidin-4-amine.
| Compound Name | 1-cyclopropylsulfonyl-N-[2,6-dinitro-4-(trifluoromethyl)phenyl]piperidin-4-amine |
|---|---|
| PubChem CID | 133348549 |
| Molecular Formula | C15H17F3N4O6S |
| Molecular Weight | 438.38 g/mol |
| Exact Mass | 438.08 |
| IUPAC Name | 1-cyclopropylsulfonyl-N-[2,6-dinitro-4-(trifluoromethyl)phenyl]piperidin-4-amine |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)cc([N+](=O)[O-])c1NC1CCN(S(=O)(=O)C2CC2)CC1 |
| InChI | InChI=1S/C15H17F3N4O6S/c16-15(17,18)9-7-12(21(23)24)14(13(8-9)22(25)26)19-10-3-5-20(6-4-10)29(27,28)11-1-2-11/h7-8,10-11,19H,1-6H2 |
| InChIKey | SRSYQPPGDXNBDB-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 135.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.38 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|