C17H21F3N4O5 — CID 133305309
N-[2,6-dinitro-4-(trifluoromethyl)phenyl]-1-(oxolan-3-ylmethyl)piperidin-4-amine (PubChem CID 133305309) has the molecular formula C17H21F3N4O5 and a molecular weight of 418.37 g/mol. Its IUPAC name is N-[2,6-dinitro-4-(trifluoromethyl)phenyl]-1-(oxolan-3-ylmethyl)piperidin-4-amine.
| Compound Name | N-[2,6-dinitro-4-(trifluoromethyl)phenyl]-1-(oxolan-3-ylmethyl)piperidin-4-amine |
|---|---|
| PubChem CID | 133305309 |
| Molecular Formula | C17H21F3N4O5 |
| Molecular Weight | 418.37 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | N-[2,6-dinitro-4-(trifluoromethyl)phenyl]-1-(oxolan-3-ylmethyl)piperidin-4-amine |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)cc([N+](=O)[O-])c1NC1CCN(CC2CCOC2)CC1 |
| InChI | InChI=1S/C17H21F3N4O5/c18-17(19,20)12-7-14(23(25)26)16(15(8-12)24(27)28)21-13-1-4-22(5-2-13)9-11-3-6-29-10-11/h7-8,11,13,21H,1-6,9-10H2 |
| InChIKey | PJNJDAXTUUYWGH-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 110.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.37 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|