C18H23N5O4 — CID 137271087
6-nitro-7-[[1-(oxolan-3-ylmethyl)piperidin-4-yl]amino]-3H-quinazolin-4-one (PubChem CID 137271087) has the molecular formula C18H23N5O4 and a molecular weight of 373.41 g/mol. Its IUPAC name is 6-nitro-7-[[1-(oxolan-3-ylmethyl)piperidin-4-yl]amino]-3H-quinazolin-4-one.
| Compound Name | 6-nitro-7-[[1-(oxolan-3-ylmethyl)piperidin-4-yl]amino]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 137271087 |
| Molecular Formula | C18H23N5O4 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | 6-nitro-7-[[1-(oxolan-3-ylmethyl)piperidin-4-yl]amino]-3H-quinazolin-4-one |
| SMILES | O=c1[nH]cnc2cc(NC3CCN(CC4CCOC4)CC3)c([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C18H23N5O4/c24-18-14-7-17(23(25)26)16(8-15(14)19-11-20-18)21-13-1-4-22(5-2-13)9-12-3-6-27-10-12/h7-8,11-13,21H,1-6,9-10H2,(H,19,20,24) |
| InChIKey | CBZHPHVZJRTQEF-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 113.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|