C17H22F3N3O5S — CID 133305227
N-[2-nitro-4-(trifluoromethylsulfonyl)phenyl]-1-(oxolan-3-ylmethyl)piperidin-4-amine (PubChem CID 133305227) has the molecular formula C17H22F3N3O5S and a molecular weight of 437.44 g/mol. Its IUPAC name is N-[2-nitro-4-(trifluoromethylsulfonyl)phenyl]-1-(oxolan-3-ylmethyl)piperidin-4-amine.
| Compound Name | N-[2-nitro-4-(trifluoromethylsulfonyl)phenyl]-1-(oxolan-3-ylmethyl)piperidin-4-amine |
|---|---|
| PubChem CID | 133305227 |
| Molecular Formula | C17H22F3N3O5S |
| Molecular Weight | 437.44 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | N-[2-nitro-4-(trifluoromethylsulfonyl)phenyl]-1-(oxolan-3-ylmethyl)piperidin-4-amine |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)C(F)(F)F)ccc1NC1CCN(CC2CCOC2)CC1 |
| InChI | InChI=1S/C17H22F3N3O5S/c18-17(19,20)29(26,27)14-1-2-15(16(9-14)23(24)25)21-13-3-6-22(7-4-13)10-12-5-8-28-11-12/h1-2,9,12-13,21H,3-8,10-11H2 |
| InChIKey | HIHBTAZSTHMGIS-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.44 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|