C15H20F3N3O5S — CID 52506203
N-[[(3S)-1-(2-methoxyethyl)pyrrolidin-3-yl]methyl]-2-nitro-4-(trifluoromethylsulfonyl)aniline (PubChem CID 52506203) has the molecular formula C15H20F3N3O5S and a molecular weight of 411.40 g/mol. Its IUPAC name is N-[[(3S)-1-(2-methoxyethyl)pyrrolidin-3-yl]methyl]-2-nitro-4-(trifluoromethylsulfonyl)aniline.
| Compound Name | N-[[(3S)-1-(2-methoxyethyl)pyrrolidin-3-yl]methyl]-2-nitro-4-(trifluoromethylsulfonyl)aniline |
|---|---|
| PubChem CID | 52506203 |
| Molecular Formula | C15H20F3N3O5S |
| Molecular Weight | 411.40 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | N-[[(3S)-1-(2-methoxyethyl)pyrrolidin-3-yl]methyl]-2-nitro-4-(trifluoromethylsulfonyl)aniline |
| SMILES | COCCN1CC[C@@H](CNc2ccc(S(=O)(=O)C(F)(F)F)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C15H20F3N3O5S/c1-26-7-6-20-5-4-11(10-20)9-19-13-3-2-12(8-14(13)21(22)23)27(24,25)15(16,17)18/h2-3,8,11,19H,4-7,9-10H2,1H3/t11-/m0/s1 |
| InChIKey | XTECGRRJJNUVJF-NSHDSACASA-N |
| XLogP | 2.27 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.40 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|