C20H29N5O4S — CID 71854386
2-[4-[[4-(azepan-1-ylsulfonyl)-2-nitroanilino]methyl]piperidin-1-yl]acetonitrile (PubChem CID 71854386) has the molecular formula C20H29N5O4S and a molecular weight of 435.55 g/mol. Its IUPAC name is 2-[4-[[4-(azepan-1-ylsulfonyl)-2-nitroanilino]methyl]piperidin-1-yl]acetonitrile.
| Compound Name | 2-[4-[[4-(azepan-1-ylsulfonyl)-2-nitroanilino]methyl]piperidin-1-yl]acetonitrile |
|---|---|
| PubChem CID | 71854386 |
| Molecular Formula | C20H29N5O4S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | 2-[4-[[4-(azepan-1-ylsulfonyl)-2-nitroanilino]methyl]piperidin-1-yl]acetonitrile |
| SMILES | N#CCN1CCC(CNc2ccc(S(=O)(=O)N3CCCCCC3)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C20H29N5O4S/c21-9-14-23-12-7-17(8-13-23)16-22-19-6-5-18(15-20(19)25(26)27)30(28,29)24-10-3-1-2-4-11-24/h5-6,15,17,22H,1-4,7-8,10-14,16H2 |
| InChIKey | BBFKKTUAKHBVPJ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 119.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|