C18H30N2O3S — CID 131931555
4-tert-butyl-N-[[1-(2-methoxyethyl)pyrrolidin-3-yl]methyl]benzenesulfonamide (PubChem CID 131931555) has the molecular formula C18H30N2O3S and a molecular weight of 354.52 g/mol. Its IUPAC name is 4-tert-butyl-N-[[1-(2-methoxyethyl)pyrrolidin-3-yl]methyl]benzenesulfonamide.
| Compound Name | 4-tert-butyl-N-[[1-(2-methoxyethyl)pyrrolidin-3-yl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 131931555 |
| Molecular Formula | C18H30N2O3S |
| Molecular Weight | 354.52 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | 4-tert-butyl-N-[[1-(2-methoxyethyl)pyrrolidin-3-yl]methyl]benzenesulfonamide |
| SMILES | COCCN1CCC(CNS(=O)(=O)c2ccc(C(C)(C)C)cc2)C1 |
| InChI | InChI=1S/C18H30N2O3S/c1-18(2,3)16-5-7-17(8-6-16)24(21,22)19-13-15-9-10-20(14-15)11-12-23-4/h5-8,15,19H,9-14H2,1-4H3 |
| InChIKey | MVYGKRTVCPGUDB-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.52 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |