C12H19N3O6S2 — CID 90410060
4-[(1,1-dihydroxythian-4-yl)methylamino]-3-nitrobenzenesulfonamide (PubChem CID 90410060) has the molecular formula C12H19N3O6S2 and a molecular weight of 365.43 g/mol. Its IUPAC name is 4-[(1,1-dihydroxythian-4-yl)methylamino]-3-nitrobenzenesulfonamide.
| Compound Name | 4-[(1,1-dihydroxythian-4-yl)methylamino]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 90410060 |
| Molecular Formula | C12H19N3O6S2 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | 4-[(1,1-dihydroxythian-4-yl)methylamino]-3-nitrobenzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(NCC2CCS(O)(O)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H19N3O6S2/c13-23(20,21)10-1-2-11(12(7-10)15(16)17)14-8-9-3-5-22(18,19)6-4-9/h1-2,7,9,14,18-19H,3-6,8H2,(H2,13,20,21) |
| InChIKey | QSIHSUCUJHRMLA-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 155.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|