C17H21F3N4O7S — CID 175102257
[[3-nitro-4-[[1-(oxetan-3-yl)piperidin-4-yl]methylamino]phenyl]sulfonylamino] 2,2,2-trifluoroacetate (PubChem CID 175102257) has the molecular formula C17H21F3N4O7S and a molecular weight of 482.44 g/mol. Its IUPAC name is [[3-nitro-4-[[1-(oxetan-3-yl)piperidin-4-yl]methylamino]phenyl]sulfonylamino] 2,2,2-trifluoroacetate.
| Compound Name | [[3-nitro-4-[[1-(oxetan-3-yl)piperidin-4-yl]methylamino]phenyl]sulfonylamino] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 175102257 |
| Molecular Formula | C17H21F3N4O7S |
| Molecular Weight | 482.44 g/mol |
| Exact Mass | 482.11 |
| IUPAC Name | [[3-nitro-4-[[1-(oxetan-3-yl)piperidin-4-yl]methylamino]phenyl]sulfonylamino] 2,2,2-trifluoroacetate |
| SMILES | O=C(ONS(=O)(=O)c1ccc(NCC2CCN(C3COC3)CC2)c([N+](=O)[O-])c1)C(F)(F)F |
| InChI | InChI=1S/C17H21F3N4O7S/c18-17(19,20)16(25)31-22-32(28,29)13-1-2-14(15(7-13)24(26)27)21-8-11-3-5-23(6-4-11)12-9-30-10-12/h1-2,7,11-12,21-22H,3-6,8-10H2 |
| InChIKey | GJTABPZRNMKJFY-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 140.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.44 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|