C19H29N3O3 — CID 97322617
N-[(1S)-1-(4-methyl-3-nitrophenyl)ethyl]-1-[[(3R)-oxolan-3-yl]methyl]piperidin-4-amine (PubChem CID 97322617) has the molecular formula C19H29N3O3 and a molecular weight of 347.46 g/mol. Its IUPAC name is N-[(1S)-1-(4-methyl-3-nitrophenyl)ethyl]-1-[[(3R)-oxolan-3-yl]methyl]piperidin-4-amine.
| Compound Name | N-[(1S)-1-(4-methyl-3-nitrophenyl)ethyl]-1-[[(3R)-oxolan-3-yl]methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 97322617 |
| Molecular Formula | C19H29N3O3 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | N-[(1S)-1-(4-methyl-3-nitrophenyl)ethyl]-1-[[(3R)-oxolan-3-yl]methyl]piperidin-4-amine |
| SMILES | Cc1ccc([C@H](C)NC2CCN(C[C@H]3CCOC3)CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H29N3O3/c1-14-3-4-17(11-19(14)22(23)24)15(2)20-18-5-8-21(9-6-18)12-16-7-10-25-13-16/h3-4,11,15-16,18,20H,5-10,12-13H2,1-2H3/t15-,16+/m0/s1 |
| InChIKey | ZKQWYMXVXYADSG-JKSUJKDBSA-N |
| XLogP | 3.05 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|