C16H21ClF3N3O3S — CID 133311648
3-chloro-N-[1-(oxan-4-ylsulfonyl)piperidin-4-yl]-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 133311648) has the molecular formula C16H21ClF3N3O3S and a molecular weight of 427.88 g/mol. Its IUPAC name is 3-chloro-N-[1-(oxan-4-ylsulfonyl)piperidin-4-yl]-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 3-chloro-N-[1-(oxan-4-ylsulfonyl)piperidin-4-yl]-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 133311648 |
| Molecular Formula | C16H21ClF3N3O3S |
| Molecular Weight | 427.88 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | 3-chloro-N-[1-(oxan-4-ylsulfonyl)piperidin-4-yl]-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | O=S(=O)(C1CCOCC1)N1CCC(Nc2ncc(C(F)(F)F)cc2Cl)CC1 |
| InChI | InChI=1S/C16H21ClF3N3O3S/c17-14-9-11(16(18,19)20)10-21-15(14)22-12-1-5-23(6-2-12)27(24,25)13-3-7-26-8-4-13/h9-10,12-13H,1-8H2,(H,21,22) |
| InChIKey | KOZAQBOBCHLVLR-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.88 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |