C18H24N4O3S — CID 133311667
N-[1-(oxan-4-ylsulfonyl)piperidin-4-yl]quinazolin-4-amine (PubChem CID 133311667) has the molecular formula C18H24N4O3S and a molecular weight of 376.48 g/mol. Its IUPAC name is N-[1-(oxan-4-ylsulfonyl)piperidin-4-yl]quinazolin-4-amine.
| Compound Name | N-[1-(oxan-4-ylsulfonyl)piperidin-4-yl]quinazolin-4-amine |
|---|---|
| PubChem CID | 133311667 |
| Molecular Formula | C18H24N4O3S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | N-[1-(oxan-4-ylsulfonyl)piperidin-4-yl]quinazolin-4-amine |
| SMILES | O=S(=O)(C1CCOCC1)N1CCC(Nc2ncnc3ccccc23)CC1 |
| InChI | InChI=1S/C18H24N4O3S/c23-26(24,15-7-11-25-12-8-15)22-9-5-14(6-10-22)21-18-16-3-1-2-4-17(16)19-13-20-18/h1-4,13-15H,5-12H2,(H,19,20,21) |
| InChIKey | NJHKZUDJDXWEDW-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |