About 4-chloro-2-methyl-3,5-dinitrobenzonitrile
4-chloro-2-methyl-3,5-dinitrobenzonitrile (PubChem CID 20563860) has the molecular formula C8H4ClN3O4
and a molecular weight of 241.59 g/mol. Its IUPAC name is 4-chloro-2-methyl-3,5-dinitrobenzonitrile.
Molecular Properties
| Compound Name | 4-chloro-2-methyl-3,5-dinitrobenzonitrile |
| PubChem CID | 20563860 |
| Molecular Formula | C8H4ClN3O4 |
| Molecular Weight | 241.59 g/mol |
| Exact Mass | 240.99 |
| IUPAC Name | 4-chloro-2-methyl-3,5-dinitrobenzonitrile |
| SMILES | Cc1c(C#N)cc([N+](=O)[O-])c(Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C8H4ClN3O4/c1-4-5(3-10)2-6(11(13)14)7(9)8(4)12(15)16/h2H,1H3 |
| InChIKey | ICEBEFCXCVJODR-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 110.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.59 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-2-methyl-3,5-dinitrobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-methyl-3,5-dinitrobenzonitrile?
The IUPAC name of 4-chloro-2-methyl-3,5-dinitrobenzonitrile (CID 20563860) is 4-chloro-2-methyl-3,5-dinitrobenzonitrile.
What is the SMILES notation for 4-chloro-2-methyl-3,5-dinitrobenzonitrile?
The canonical SMILES for 4-chloro-2-methyl-3,5-dinitrobenzonitrile is Cc1c(C#N)cc([N+](=O)[O-])c(Cl)c1[N+](=O)[O-].
What is the InChIKey of 4-chloro-2-methyl-3,5-dinitrobenzonitrile?
The InChIKey is ICEBEFCXCVJODR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4ClN3O4/c1-4-5(3-10)2-6(11(13)14)7(9)8(4)12(15)16/h2H,1H3.
What are the key properties of 4-chloro-2-methyl-3,5-dinitrobenzonitrile?
4-chloro-2-methyl-3,5-dinitrobenzonitrile has a molecular weight of 241.59 g/mol, XLogP of 2.34, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-methyl-3,5-dinitrobenzonitrile is sourced from PubChem (CID 20563860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).