C10H11ClN2O4 — CID 131861051
4-chloro-2-methyl-1,3-dinitro-5-propan-2-ylbenzene (PubChem CID 131861051) has the molecular formula C10H11ClN2O4 and a molecular weight of 258.66 g/mol. Its IUPAC name is 4-chloro-2-methyl-1,3-dinitro-5-propan-2-ylbenzene.
| Compound Name | 4-chloro-2-methyl-1,3-dinitro-5-propan-2-ylbenzene |
|---|---|
| PubChem CID | 131861051 |
| Molecular Formula | C10H11ClN2O4 |
| Molecular Weight | 258.66 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | 4-chloro-2-methyl-1,3-dinitro-5-propan-2-ylbenzene |
| SMILES | Cc1c([N+](=O)[O-])cc(C(C)C)c(Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H11ClN2O4/c1-5(2)7-4-8(12(14)15)6(3)10(9(7)11)13(16)17/h4-5H,1-3H3 |
| InChIKey | CRYBVQJSAXCHNH-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.66 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|