C13H19NO3 — CID 23403382
3-methyl-6-nitro-2,4-di(propan-2-yl)phenol (PubChem CID 23403382) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is 3-methyl-6-nitro-2,4-di(propan-2-yl)phenol.
| Compound Name | 3-methyl-6-nitro-2,4-di(propan-2-yl)phenol |
|---|---|
| PubChem CID | 23403382 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | 3-methyl-6-nitro-2,4-di(propan-2-yl)phenol |
| SMILES | Cc1c(C(C)C)cc([N+](=O)[O-])c(O)c1C(C)C |
| InChI | InChI=1S/C13H19NO3/c1-7(2)10-6-11(14(16)17)13(15)12(8(3)4)9(10)5/h6-8,15H,1-5H3 |
| InChIKey | WSAGGCKSHFGAHD-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|