C10H14N2O4 — CID 131360385
2-[(1S,2R)-1-amino-2-hydroxypropyl]-4-methyl-6-nitrophenol (PubChem CID 131360385) has the molecular formula C10H14N2O4 and a molecular weight of 226.23 g/mol. Its IUPAC name is 2-[(1S,2R)-1-amino-2-hydroxypropyl]-4-methyl-6-nitrophenol.
| Compound Name | 2-[(1S,2R)-1-amino-2-hydroxypropyl]-4-methyl-6-nitrophenol |
|---|---|
| PubChem CID | 131360385 |
| Molecular Formula | C10H14N2O4 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 2-[(1S,2R)-1-amino-2-hydroxypropyl]-4-methyl-6-nitrophenol |
| SMILES | Cc1cc([C@H](N)[C@@H](C)O)c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H14N2O4/c1-5-3-7(9(11)6(2)13)10(14)8(4-5)12(15)16/h3-4,6,9,13-14H,11H2,1-2H3/t6-,9-/m1/s1 |
| InChIKey | GRKROJYIAIFVJM-HZGVNTEJSA-N |
| XLogP | 0.99 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|