C12H18N2O2 — CID 21491970
4-nitro-2,5-di(propan-2-yl)aniline (PubChem CID 21491970) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is 4-nitro-2,5-di(propan-2-yl)aniline.
| Compound Name | 4-nitro-2,5-di(propan-2-yl)aniline |
|---|---|
| PubChem CID | 21491970 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 4-nitro-2,5-di(propan-2-yl)aniline |
| SMILES | CC(C)c1cc([N+](=O)[O-])c(C(C)C)cc1N |
| InChI | InChI=1S/C12H18N2O2/c1-7(2)9-6-12(14(15)16)10(8(3)4)5-11(9)13/h5-8H,13H2,1-4H3 |
| InChIKey | AWKUWKAHTVUURR-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|