C17H17ClN4O5 — CID 165365293
4-[(6-chloro-3-methyl-2,4-dinitrophenyl)diazenyl]-5-methyl-2-propan-2-ylphenol (PubChem CID 165365293) has the molecular formula C17H17ClN4O5 and a molecular weight of 392.80 g/mol. Its IUPAC name is 4-[(6-chloro-3-methyl-2,4-dinitrophenyl)diazenyl]-5-methyl-2-propan-2-ylphenol.
| Compound Name | 4-[(6-chloro-3-methyl-2,4-dinitrophenyl)diazenyl]-5-methyl-2-propan-2-ylphenol |
|---|---|
| PubChem CID | 165365293 |
| Molecular Formula | C17H17ClN4O5 |
| Molecular Weight | 392.80 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | 4-[(6-chloro-3-methyl-2,4-dinitrophenyl)diazenyl]-5-methyl-2-propan-2-ylphenol |
| SMILES | Cc1cc(O)c(C(C)C)cc1/N=N/c1c(Cl)cc([N+](=O)[O-])c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C17H17ClN4O5/c1-8(2)11-6-13(9(3)5-15(11)23)19-20-16-12(18)7-14(21(24)25)10(4)17(16)22(26)27/h5-8,23H,1-4H3/b20-19+ |
| InChIKey | LWSJHHYWSMPMKA-FMQUCBEESA-N |
| XLogP | 6.02 |
| TPSA | 131.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.80 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|