C14H19Br2NO2 — CID 134935929
1,4-dibromo-2,5-ditert-butyl-3-nitrobenzene (PubChem CID 134935929) has the molecular formula C14H19Br2NO2 and a molecular weight of 393.12 g/mol. Its IUPAC name is 1,4-dibromo-2,5-ditert-butyl-3-nitrobenzene.
| Compound Name | 1,4-dibromo-2,5-ditert-butyl-3-nitrobenzene |
|---|---|
| PubChem CID | 134935929 |
| Molecular Formula | C14H19Br2NO2 |
| Molecular Weight | 393.12 g/mol |
| Exact Mass | 390.98 |
| IUPAC Name | 1,4-dibromo-2,5-ditert-butyl-3-nitrobenzene |
| SMILES | CC(C)(C)c1cc(Br)c(C(C)(C)C)c([N+](=O)[O-])c1Br |
| InChI | InChI=1S/C14H19Br2NO2/c1-13(2,3)8-7-9(15)10(14(4,5)6)12(11(8)16)17(18)19/h7H,1-6H3 |
| InChIKey | VZIGBQQATUESNR-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.12 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|