C18H28BrF — CID 71355768
2-bromo-1,3,5-tritert-butyl-4-fluorobenzene (PubChem CID 71355768) has the molecular formula C18H28BrF and a molecular weight of 343.32 g/mol. Its IUPAC name is 2-bromo-1,3,5-tritert-butyl-4-fluorobenzene.
| Compound Name | 2-bromo-1,3,5-tritert-butyl-4-fluorobenzene |
|---|---|
| PubChem CID | 71355768 |
| Molecular Formula | C18H28BrF |
| Molecular Weight | 343.32 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 2-bromo-1,3,5-tritert-butyl-4-fluorobenzene |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c(Br)c(C(C)(C)C)c1F |
| InChI | InChI=1S/C18H28BrF/c1-16(2,3)11-10-12(17(4,5)6)15(20)13(14(11)19)18(7,8)9/h10H,1-9H3 |
| InChIKey | ORYMDZYSJWUFLT-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.32 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |