About 1-bromo-5-tert-butyl-2,4-difluorobenzene
1-bromo-5-tert-butyl-2,4-difluorobenzene (PubChem CID 153434868) has the molecular formula C10H11BrF2
and a molecular weight of 249.10 g/mol. Its IUPAC name is 1-bromo-5-tert-butyl-2,4-difluorobenzene.
Molecular Properties
| Compound Name | 1-bromo-5-tert-butyl-2,4-difluorobenzene |
| PubChem CID | 153434868 |
| Molecular Formula | C10H11BrF2 |
| Molecular Weight | 249.10 g/mol |
| Exact Mass | 248.00 |
| IUPAC Name | 1-bromo-5-tert-butyl-2,4-difluorobenzene |
| SMILES | CC(C)(C)c1cc(Br)c(F)cc1F |
| InChI | InChI=1S/C10H11BrF2/c1-10(2,3)6-4-7(11)9(13)5-8(6)12/h4-5H,1-3H3 |
| InChIKey | YBRFQFCPHYEZKL-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.10 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-5-tert-butyl-2,4-difluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-5-tert-butyl-2,4-difluorobenzene?
The IUPAC name of 1-bromo-5-tert-butyl-2,4-difluorobenzene (CID 153434868) is 1-bromo-5-tert-butyl-2,4-difluorobenzene.
What is the SMILES notation for 1-bromo-5-tert-butyl-2,4-difluorobenzene?
The canonical SMILES for 1-bromo-5-tert-butyl-2,4-difluorobenzene is CC(C)(C)c1cc(Br)c(F)cc1F.
What is the InChIKey of 1-bromo-5-tert-butyl-2,4-difluorobenzene?
The InChIKey is YBRFQFCPHYEZKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11BrF2/c1-10(2,3)6-4-7(11)9(13)5-8(6)12/h4-5H,1-3H3.
What are the key properties of 1-bromo-5-tert-butyl-2,4-difluorobenzene?
1-bromo-5-tert-butyl-2,4-difluorobenzene has a molecular weight of 249.10 g/mol, XLogP of 4.02, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-5-tert-butyl-2,4-difluorobenzene is sourced from PubChem (CID 153434868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).