C10H10BrF4NO — CID 71008979
(3R)-3-amino-3-(5-bromo-2,4-difluorophenyl)-2,2-difluorobutan-1-ol (PubChem CID 71008979) has the molecular formula C10H10BrF4NO and a molecular weight of 316.09 g/mol. Its IUPAC name is (3R)-3-amino-3-(5-bromo-2,4-difluorophenyl)-2,2-difluorobutan-1-ol.
| Compound Name | (3R)-3-amino-3-(5-bromo-2,4-difluorophenyl)-2,2-difluorobutan-1-ol |
|---|---|
| PubChem CID | 71008979 |
| Molecular Formula | C10H10BrF4NO |
| Molecular Weight | 316.09 g/mol |
| Exact Mass | 314.99 |
| IUPAC Name | (3R)-3-amino-3-(5-bromo-2,4-difluorophenyl)-2,2-difluorobutan-1-ol |
| SMILES | C[C@@](N)(c1cc(Br)c(F)cc1F)C(F)(F)CO |
| InChI | InChI=1S/C10H10BrF4NO/c1-9(16,10(14,15)4-17)5-2-6(11)8(13)3-7(5)12/h2-3,17H,4,16H2,1H3/t9-/m1/s1 |
| InChIKey | JQKLUXJOZUCDTA-SECBINFHSA-N |
| XLogP | 2.53 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.09 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|