C11H13BrF3NO — CID 71742847
4-amino-4-(5-bromo-2-fluorophenyl)-2,2-difluoropentan-1-ol (PubChem CID 71742847) has the molecular formula C11H13BrF3NO and a molecular weight of 312.13 g/mol. Its IUPAC name is 4-amino-4-(5-bromo-2-fluorophenyl)-2,2-difluoropentan-1-ol.
| Compound Name | 4-amino-4-(5-bromo-2-fluorophenyl)-2,2-difluoropentan-1-ol |
|---|---|
| PubChem CID | 71742847 |
| Molecular Formula | C11H13BrF3NO |
| Molecular Weight | 312.13 g/mol |
| Exact Mass | 311.01 |
| IUPAC Name | 4-amino-4-(5-bromo-2-fluorophenyl)-2,2-difluoropentan-1-ol |
| SMILES | CC(N)(CC(F)(F)CO)c1cc(Br)ccc1F |
| InChI | InChI=1S/C11H13BrF3NO/c1-10(16,5-11(14,15)6-17)8-4-7(12)2-3-9(8)13/h2-4,17H,5-6,16H2,1H3 |
| InChIKey | AYYAASGDEADLKX-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.13 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |