C14H20BrF3NOS+ — CID 152885106
[[(2R)-2-(5-bromo-2-fluorophenyl)-3,3-difluoro-4-hydroxybutan-2-yl]amino]-tert-butylsulfanium (PubChem CID 152885106) has the molecular formula C14H20BrF3NOS+ and a molecular weight of 387.29 g/mol. Its IUPAC name is [[(2R)-2-(5-bromo-2-fluorophenyl)-3,3-difluoro-4-hydroxybutan-2-yl]amino]-tert-butylsulfanium.
| Compound Name | [[(2R)-2-(5-bromo-2-fluorophenyl)-3,3-difluoro-4-hydroxybutan-2-yl]amino]-tert-butylsulfanium |
|---|---|
| PubChem CID | 152885106 |
| Molecular Formula | C14H20BrF3NOS+ |
| Molecular Weight | 387.29 g/mol |
| Exact Mass | 386.04 |
| IUPAC Name | [[(2R)-2-(5-bromo-2-fluorophenyl)-3,3-difluoro-4-hydroxybutan-2-yl]amino]-tert-butylsulfanium |
| SMILES | CC(C)(C)[SH+]N[C@](C)(c1cc(Br)ccc1F)C(F)(F)CO |
| InChI | InChI=1S/C14H19BrF3NOS/c1-12(2,3)21-19-13(4,14(17,18)8-20)10-7-9(15)5-6-11(10)16/h5-7,19-20H,8H2,1-4H3/p+1/t13-/m1/s1 |
| InChIKey | UCFZCQDRNUTAMU-CYBMUJFWSA-O |
| XLogP | 3.55 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.29 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|