C15H24BrFN2O — CID 82973754
2-(5-bromo-2-fluorophenyl)-2-[2-(diethylamino)ethylamino]propan-1-ol (PubChem CID 82973754) has the molecular formula C15H24BrFN2O and a molecular weight of 347.27 g/mol. Its IUPAC name is 2-(5-bromo-2-fluorophenyl)-2-[2-(diethylamino)ethylamino]propan-1-ol.
| Compound Name | 2-(5-bromo-2-fluorophenyl)-2-[2-(diethylamino)ethylamino]propan-1-ol |
|---|---|
| PubChem CID | 82973754 |
| Molecular Formula | C15H24BrFN2O |
| Molecular Weight | 347.27 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | 2-(5-bromo-2-fluorophenyl)-2-[2-(diethylamino)ethylamino]propan-1-ol |
| SMILES | CCN(CC)CCNC(C)(CO)c1cc(Br)ccc1F |
| InChI | InChI=1S/C15H24BrFN2O/c1-4-19(5-2)9-8-18-15(3,11-20)13-10-12(16)6-7-14(13)17/h6-7,10,18,20H,4-5,8-9,11H2,1-3H3 |
| InChIKey | GZAYSZJGLMQNHI-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.27 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |