C15H25BrN2O — CID 61048823
2-(3-bromophenyl)-2-[2-(diethylamino)ethylamino]propan-1-ol (PubChem CID 61048823) has the molecular formula C15H25BrN2O and a molecular weight of 329.28 g/mol. Its IUPAC name is 2-(3-bromophenyl)-2-[2-(diethylamino)ethylamino]propan-1-ol.
| Compound Name | 2-(3-bromophenyl)-2-[2-(diethylamino)ethylamino]propan-1-ol |
|---|---|
| PubChem CID | 61048823 |
| Molecular Formula | C15H25BrN2O |
| Molecular Weight | 329.28 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 2-(3-bromophenyl)-2-[2-(diethylamino)ethylamino]propan-1-ol |
| SMILES | CCN(CC)CCNC(C)(CO)c1cccc(Br)c1 |
| InChI | InChI=1S/C15H25BrN2O/c1-4-18(5-2)10-9-17-15(3,12-19)13-7-6-8-14(16)11-13/h6-8,11,17,19H,4-5,9-10,12H2,1-3H3 |
| InChIKey | XXLCEEVYRGTMFL-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.28 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |