C12H12BrClF3NO2 — CID 66665738
N-[2-(5-bromo-2-fluorophenyl)-3,3-difluoro-4-hydroxybutan-2-yl]-2-chloroacetamide (PubChem CID 66665738) has the molecular formula C12H12BrClF3NO2 and a molecular weight of 374.58 g/mol. Its IUPAC name is N-[2-(5-bromo-2-fluorophenyl)-3,3-difluoro-4-hydroxybutan-2-yl]-2-chloroacetamide.
| Compound Name | N-[2-(5-bromo-2-fluorophenyl)-3,3-difluoro-4-hydroxybutan-2-yl]-2-chloroacetamide |
|---|---|
| PubChem CID | 66665738 |
| Molecular Formula | C12H12BrClF3NO2 |
| Molecular Weight | 374.58 g/mol |
| Exact Mass | 372.97 |
| IUPAC Name | N-[2-(5-bromo-2-fluorophenyl)-3,3-difluoro-4-hydroxybutan-2-yl]-2-chloroacetamide |
| SMILES | CC(NC(=O)CCl)(c1cc(Br)ccc1F)C(F)(F)CO |
| InChI | InChI=1S/C12H12BrClF3NO2/c1-11(12(16,17)6-19,18-10(20)5-14)8-4-7(13)2-3-9(8)15/h2-4,19H,5-6H2,1H3,(H,18,20) |
| InChIKey | WCUJDTDSCRDAAD-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.58 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|