C11H12BrClFNO3 — CID 66665606
N-[2-(5-bromo-2-fluorophenyl)-1,3-dihydroxypropan-2-yl]-2-chloroacetamide (PubChem CID 66665606) has the molecular formula C11H12BrClFNO3 and a molecular weight of 340.58 g/mol. Its IUPAC name is N-[2-(5-bromo-2-fluorophenyl)-1,3-dihydroxypropan-2-yl]-2-chloroacetamide.
| Compound Name | N-[2-(5-bromo-2-fluorophenyl)-1,3-dihydroxypropan-2-yl]-2-chloroacetamide |
|---|---|
| PubChem CID | 66665606 |
| Molecular Formula | C11H12BrClFNO3 |
| Molecular Weight | 340.58 g/mol |
| Exact Mass | 338.97 |
| IUPAC Name | N-[2-(5-bromo-2-fluorophenyl)-1,3-dihydroxypropan-2-yl]-2-chloroacetamide |
| SMILES | O=C(CCl)NC(CO)(CO)c1cc(Br)ccc1F |
| InChI | InChI=1S/C11H12BrClFNO3/c12-7-1-2-9(14)8(3-7)11(5-16,6-17)15-10(18)4-13/h1-3,16-17H,4-6H2,(H,15,18) |
| InChIKey | CUUKNIPRGANVEE-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.58 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|