C10H11BrF3NO — CID 66666062
3-amino-3-(5-bromo-2-fluorophenyl)-2,2-difluorobutan-1-ol (PubChem CID 66666062) has the molecular formula C10H11BrF3NO and a molecular weight of 298.10 g/mol. Its IUPAC name is 3-amino-3-(5-bromo-2-fluorophenyl)-2,2-difluorobutan-1-ol.
| Compound Name | 3-amino-3-(5-bromo-2-fluorophenyl)-2,2-difluorobutan-1-ol |
|---|---|
| PubChem CID | 66666062 |
| Molecular Formula | C10H11BrF3NO |
| Molecular Weight | 298.10 g/mol |
| Exact Mass | 297.00 |
| IUPAC Name | 3-amino-3-(5-bromo-2-fluorophenyl)-2,2-difluorobutan-1-ol |
| SMILES | CC(N)(c1cc(Br)ccc1F)C(F)(F)CO |
| InChI | InChI=1S/C10H11BrF3NO/c1-9(15,10(13,14)5-16)7-4-6(11)2-3-8(7)12/h2-4,16H,5,15H2,1H3 |
| InChIKey | GXDBBLGEZPJVHO-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.10 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |