C18H18BrF2NO3 — CID 146342831
benzyl N-[2-(5-bromo-2-fluorophenyl)-1-fluoro-4-hydroxybutan-2-yl]carbamate (PubChem CID 146342831) has the molecular formula C18H18BrF2NO3 and a molecular weight of 414.25 g/mol. Its IUPAC name is benzyl N-[2-(5-bromo-2-fluorophenyl)-1-fluoro-4-hydroxybutan-2-yl]carbamate.
| Compound Name | benzyl N-[2-(5-bromo-2-fluorophenyl)-1-fluoro-4-hydroxybutan-2-yl]carbamate |
|---|---|
| PubChem CID | 146342831 |
| Molecular Formula | C18H18BrF2NO3 |
| Molecular Weight | 414.25 g/mol |
| Exact Mass | 413.04 |
| IUPAC Name | benzyl N-[2-(5-bromo-2-fluorophenyl)-1-fluoro-4-hydroxybutan-2-yl]carbamate |
| SMILES | O=C(NC(CF)(CCO)c1cc(Br)ccc1F)OCc1ccccc1 |
| InChI | InChI=1S/C18H18BrF2NO3/c19-14-6-7-16(21)15(10-14)18(12-20,8-9-23)22-17(24)25-11-13-4-2-1-3-5-13/h1-7,10,23H,8-9,11-12H2,(H,22,24) |
| InChIKey | SVHLBOPEFKZOCS-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.25 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |